C16H21ClN2O5 — CID 7848086
[2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-methylpentanoate (PubChem CID 7848086) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-methylpentanoate.
| Compound Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-methylpentanoate |
|---|---|
| PubChem CID | 7848086 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [2-[2-(5-chloro-2-methoxybenzoyl)hydrazinyl]-2-oxoethyl] 4-methylpentanoate |
| SMILES | COc1ccc(Cl)cc1C(=O)NNC(=O)COC(=O)CCC(C)C |
| InChI | InChI=1S/C16H21ClN2O5/c1-10(2)4-7-15(21)24-9-14(20)18-19-16(22)12-8-11(17)5-6-13(12)23-3/h5-6,8,10H,4,7,9H2,1-3H3,(H,18,20)(H,19,22) |
| InChIKey | XGQCDODXRKGASQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|