C13H10BrNO4S2 — CID 8662439
[2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate (PubChem CID 8662439) has the molecular formula C13H10BrNO4S2 and a molecular weight of 388.26 g/mol. Its IUPAC name is [2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate.
| Compound Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 8662439 |
| Molecular Formula | C13H10BrNO4S2 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 386.92 |
| IUPAC Name | [2-(5-bromothiophen-2-yl)-2-oxoethyl] 2-(thiophene-2-carbonylamino)acetate |
| SMILES | O=C(CNC(=O)c1cccs1)OCC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H10BrNO4S2/c14-11-4-3-9(21-11)8(16)7-19-12(17)6-15-13(18)10-2-1-5-20-10/h1-5H,6-7H2,(H,15,18) |
| InChIKey | WYFQBGURUMBBST-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |