C12H10BrN3O3S2 — CID 40730667
N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 40730667) has the molecular formula C12H10BrN3O3S2 and a molecular weight of 388.27 g/mol. Its IUPAC name is N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 40730667 |
| Molecular Formula | C12H10BrN3O3S2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 386.93 |
| IUPAC Name | N-[2-[2-(5-bromothiophene-2-carbonyl)hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H10BrN3O3S2/c13-9-4-3-8(21-9)12(19)16-15-10(17)6-14-11(18)7-2-1-5-20-7/h1-5H,6H2,(H,14,18)(H,15,17)(H,16,19) |
| InChIKey | CFQHKUSAVBJQCQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|