C17H18BrN3O5S — CID 55835199
5-bromo-N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55835199) has the molecular formula C17H18BrN3O5S and a molecular weight of 456.32 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55835199 |
| Molecular Formula | C17H18BrN3O5S |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | 5-bromo-N-[2-[2-[2-(2-ethoxyphenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CCOc1ccccc1OCC(=O)NNC(=O)CNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C17H18BrN3O5S/c1-2-25-11-5-3-4-6-12(11)26-10-16(23)21-20-15(22)9-19-17(24)13-7-8-14(18)27-13/h3-8H,2,9-10H2,1H3,(H,19,24)(H,20,22)(H,21,23) |
| InChIKey | QHIANBLEACZTEI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|