C21H19BrN2O2S — CID 55834440
5-bromo-N-[2-(2,2-diphenylethylamino)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 55834440) has the molecular formula C21H19BrN2O2S and a molecular weight of 443.37 g/mol. Its IUPAC name is 5-bromo-N-[2-(2,2-diphenylethylamino)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(2,2-diphenylethylamino)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55834440 |
| Molecular Formula | C21H19BrN2O2S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 5-bromo-N-[2-(2,2-diphenylethylamino)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)s1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H19BrN2O2S/c22-19-12-11-18(27-19)21(26)24-14-20(25)23-13-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,17H,13-14H2,(H,23,25)(H,24,26) |
| InChIKey | VHCJJSBPFWYXOY-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |