C23H21FN2O2 — CID 26795770
N-[2-(2,2-diphenylethylamino)-2-oxoethyl]-4-fluorobenzamide (PubChem CID 26795770) has the molecular formula C23H21FN2O2 and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[2-(2,2-diphenylethylamino)-2-oxoethyl]-4-fluorobenzamide.
| Compound Name | N-[2-(2,2-diphenylethylamino)-2-oxoethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 26795770 |
| Molecular Formula | C23H21FN2O2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[2-(2,2-diphenylethylamino)-2-oxoethyl]-4-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1ccc(F)cc1)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21FN2O2/c24-20-13-11-19(12-14-20)23(28)26-16-22(27)25-15-21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H,25,27)(H,26,28) |
| InChIKey | MAQGUJLWTKENIF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |