C14H19FN2O2 — CID 17426344
4-fluoro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide (PubChem CID 17426344) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 4-fluoro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 17426344 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 4-fluoro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide |
| SMILES | CC(C)CCNC(=O)CNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O2/c1-10(2)7-8-16-13(18)9-17-14(19)11-3-5-12(15)6-4-11/h3-6,10H,7-9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | ZHLDXDUTJCOQHV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |