C14H18Cl2N2O2 — CID 27556673
3,4-dichloro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide (PubChem CID 27556673) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 27556673 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 3,4-dichloro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide |
| SMILES | CC(C)CCNC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-9(2)5-6-17-13(19)8-18-14(20)10-3-4-11(15)12(16)7-10/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | GOJWLWGOTFRDDZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |