C14H16Cl2N2O4 — CID 119234912
5-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]amino]pentanoic acid (PubChem CID 119234912) has the molecular formula C14H16Cl2N2O4 and a molecular weight of 347.20 g/mol. Its IUPAC name is 5-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]amino]pentanoic acid.
| Compound Name | 5-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 119234912 |
| Molecular Formula | C14H16Cl2N2O4 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 5-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O4/c15-10-5-4-9(7-11(10)16)14(22)18-8-12(19)17-6-2-1-3-13(20)21/h4-5,7H,1-3,6,8H2,(H,17,19)(H,18,22)(H,20,21) |
| InChIKey | KMCRVJQDWDDUCX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|