C11H11Cl2N3O3 — CID 9295430
N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-3,4-dichlorobenzamide (PubChem CID 9295430) has the molecular formula C11H11Cl2N3O3 and a molecular weight of 304.13 g/mol. Its IUPAC name is N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 9295430 |
| Molecular Formula | C11H11Cl2N3O3 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | N-[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl]-3,4-dichlorobenzamide |
| SMILES | NC(=O)CNC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2N3O3/c12-7-2-1-6(3-8(7)13)11(19)16-5-10(18)15-4-9(14)17/h1-3H,4-5H2,(H2,14,17)(H,15,18)(H,16,19) |
| InChIKey | MKPXZQCIWMGPPF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |