C15H12Cl2N4O3 — CID 9332038
3,4-dichloro-N-[2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]benzamide (PubChem CID 9332038) has the molecular formula C15H12Cl2N4O3 and a molecular weight of 367.19 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]benzamide |
|---|---|
| PubChem CID | 9332038 |
| Molecular Formula | C15H12Cl2N4O3 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 3,4-dichloro-N-[2-oxo-2-[2-(pyridine-2-carbonyl)hydrazinyl]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)NNC(=O)c1ccccn1 |
| InChI | InChI=1S/C15H12Cl2N4O3/c16-10-5-4-9(7-11(10)17)14(23)19-8-13(22)20-21-15(24)12-3-1-2-6-18-12/h1-7H,8H2,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | LDKPSBMBKQJRAG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|