C20H16Cl2N2O2 — CID 60534147
3,4-dichloro-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide (PubChem CID 60534147) has the molecular formula C20H16Cl2N2O2 and a molecular weight of 387.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 60534147 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 3,4-dichloro-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(OCc2ccccn2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N2O2/c21-18-9-6-15(11-19(18)22)20(25)24-12-14-4-7-17(8-5-14)26-13-16-3-1-2-10-23-16/h1-11H,12-13H2,(H,24,25) |
| InChIKey | SPDFVSTWBHNSPZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |