C25H21FN2O4 — CID 55902012
5-[(4-fluorophenoxy)methyl]-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]furan-2-carboxamide (PubChem CID 55902012) has the molecular formula C25H21FN2O4 and a molecular weight of 432.45 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55902012 |
| Molecular Formula | C25H21FN2O4 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccc(OCc2ccccn2)cc1)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C25H21FN2O4/c26-19-6-10-22(11-7-19)31-17-23-12-13-24(32-23)25(29)28-15-18-4-8-21(9-5-18)30-16-20-3-1-2-14-27-20/h1-14H,15-17H2,(H,28,29) |
| InChIKey | AJIHRUVIEAKLMU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |