C19H17FN2O3 — CID 87041338
5-[(4-fluorophenoxy)methyl]-N-[(6-methyl-2-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 87041338) has the molecular formula C19H17FN2O3 and a molecular weight of 340.35 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-[(6-methyl-2-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-[(6-methyl-2-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 87041338 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-[(6-methyl-2-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | Cc1cccc(CNC(=O)c2ccc(COc3ccc(F)cc3)o2)n1 |
| InChI | InChI=1S/C19H17FN2O3/c1-13-3-2-4-15(22-13)11-21-19(23)18-10-9-17(25-18)12-24-16-7-5-14(20)6-8-16/h2-10H,11-12H2,1H3,(H,21,23) |
| InChIKey | ILGCOPPRPFTNTO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |