C21H17FN4O3 — CID 46400150
5-[(4-fluorophenoxy)methyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]furan-2-carboxamide (PubChem CID 46400150) has the molecular formula C21H17FN4O3 and a molecular weight of 392.39 g/mol. Its IUPAC name is 5-[(4-fluorophenoxy)methyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]furan-2-carboxamide.
| Compound Name | 5-[(4-fluorophenoxy)methyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46400150 |
| Molecular Formula | C21H17FN4O3 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 5-[(4-fluorophenoxy)methyl]-N-[(2-pyrazol-1-yl-4-pyridinyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccnc(-n2cccn2)c1)c1ccc(COc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C21H17FN4O3/c22-16-2-4-17(5-3-16)28-14-18-6-7-19(29-18)21(27)24-13-15-8-10-23-20(12-15)26-11-1-9-25-26/h1-12H,13-14H2,(H,24,27) |
| InChIKey | IKCDZNWJTMJDKF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |