C18H17F2N5O2 — CID 35651507
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea (PubChem CID 35651507) has the molecular formula C18H17F2N5O2 and a molecular weight of 373.36 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 35651507 |
| Molecular Formula | C18H17F2N5O2 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccc(OC(F)F)cc1)NCc1ccnc(-n2cccn2)c1 |
| InChI | InChI=1S/C18H17F2N5O2/c19-17(20)27-15-4-2-13(3-5-15)11-22-18(26)23-12-14-6-8-21-16(10-14)25-9-1-7-24-25/h1-10,17H,11-12H2,(H2,22,23,26) |
| InChIKey | PZRJESZRGZBHFF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |