C16H13F2N5O — CID 86856255
1-(2,3-difluorophenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea (PubChem CID 86856255) has the molecular formula C16H13F2N5O and a molecular weight of 329.31 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(2,3-difluorophenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 86856255 |
| Molecular Formula | C16H13F2N5O |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-(2,3-difluorophenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(-n2cccn2)c1)Nc1cccc(F)c1F |
| InChI | InChI=1S/C16H13F2N5O/c17-12-3-1-4-13(15(12)18)22-16(24)20-10-11-5-7-19-14(9-11)23-8-2-6-21-23/h1-9H,10H2,(H2,20,22,24) |
| InChIKey | VGJULXJAIIDOBN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |