C19H19N5O — CID 168955827
1-(2-phenylcyclopropyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea (PubChem CID 168955827) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-(2-phenylcyclopropyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(2-phenylcyclopropyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 168955827 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-(2-phenylcyclopropyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(-n2cccn2)c1)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C19H19N5O/c25-19(23-17-12-16(17)15-5-2-1-3-6-15)21-13-14-7-9-20-18(11-14)24-10-4-8-22-24/h1-11,16-17H,12-13H2,(H2,21,23,25) |
| InChIKey | GFSXYZWZPCGLSD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |