C17H16BrN5O — CID 55696253
1-(4-bromo-3-methylphenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea (PubChem CID 55696253) has the molecular formula C17H16BrN5O and a molecular weight of 386.25 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55696253 |
| Molecular Formula | C17H16BrN5O |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
| SMILES | Cc1cc(NC(=O)NCc2ccnc(-n3cccn3)c2)ccc1Br |
| InChI | InChI=1S/C17H16BrN5O/c1-12-9-14(3-4-15(12)18)22-17(24)20-11-13-5-7-19-16(10-13)23-8-2-6-21-23/h2-10H,11H2,1H3,(H2,20,22,24) |
| InChIKey | YSBUNYNWNHAPRP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |