C20H21N5OS2 — CID 55698921
1-[3-(1,3-dithian-2-yl)phenyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea (PubChem CID 55698921) has the molecular formula C20H21N5OS2 and a molecular weight of 411.56 g/mol. Its IUPAC name is 1-[3-(1,3-dithian-2-yl)phenyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-[3-(1,3-dithian-2-yl)phenyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 55698921 |
| Molecular Formula | C20H21N5OS2 |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 1-[3-(1,3-dithian-2-yl)phenyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(-n2cccn2)c1)Nc1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C20H21N5OS2/c26-20(22-14-15-6-8-21-18(12-15)25-9-2-7-23-25)24-17-5-1-4-16(13-17)19-27-10-3-11-28-19/h1-2,4-9,12-13,19H,3,10-11,14H2,(H2,22,24,26) |
| InChIKey | PSQVTKQNXWIRHW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |