C21H21N3OS2 — CID 26129053
N-[3-(1,3-dithian-2-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide (PubChem CID 26129053) has the molecular formula C21H21N3OS2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 26129053 |
| Molecular Formula | C21H21N3OS2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]-4-(pyrazol-1-ylmethyl)benzamide |
| SMILES | O=C(Nc1cccc(C2SCCCS2)c1)c1ccc(Cn2cccn2)cc1 |
| InChI | InChI=1S/C21H21N3OS2/c25-20(17-8-6-16(7-9-17)15-24-11-2-10-22-24)23-19-5-1-4-18(14-19)21-26-12-3-13-27-21/h1-2,4-11,14,21H,3,12-13,15H2,(H,23,25) |
| InChIKey | GLZWXHLTWHVDJV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |