C18H20N2OS2 — CID 60601174
4-(dimethylamino)-N-[3-(1,3-dithiolan-2-yl)phenyl]benzamide (PubChem CID 60601174) has the molecular formula C18H20N2OS2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[3-(1,3-dithiolan-2-yl)phenyl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[3-(1,3-dithiolan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 60601174 |
| Molecular Formula | C18H20N2OS2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4-(dimethylamino)-N-[3-(1,3-dithiolan-2-yl)phenyl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2cccc(C3SCCS3)c2)cc1 |
| InChI | InChI=1S/C18H20N2OS2/c1-20(2)16-8-6-13(7-9-16)17(21)19-15-5-3-4-14(12-15)18-22-10-11-23-18/h3-9,12,18H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | PCQBOAMDCPXKGB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |