C15H15NO2S2 — CID 27022341
N-[3-(1,3-dithian-2-yl)phenyl]furan-3-carboxamide (PubChem CID 27022341) has the molecular formula C15H15NO2S2 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]furan-3-carboxamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 27022341 |
| Molecular Formula | C15H15NO2S2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1cccc(C2SCCCS2)c1)c1ccoc1 |
| InChI | InChI=1S/C15H15NO2S2/c17-14(12-5-6-18-10-12)16-13-4-1-3-11(9-13)15-19-7-2-8-20-15/h1,3-6,9-10,15H,2,7-8H2,(H,16,17) |
| InChIKey | GMTUSVFIEALQKY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |