C20H17NO3S2 — CID 27842518
N-[3-(1,3-dithian-2-yl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 27842518) has the molecular formula C20H17NO3S2 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 27842518 |
| Molecular Formula | C20H17NO3S2 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(C2SCCCS2)c1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H17NO3S2/c22-18(16-12-13-5-1-2-8-17(13)24-19(16)23)21-15-7-3-6-14(11-15)20-25-9-4-10-26-20/h1-3,5-8,11-12,20H,4,9-10H2,(H,21,22) |
| InChIKey | AYLYJLZVOZBNQK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|