C13H10N2O3S — CID 4127819
N-(4,5-dihydro-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 4127819) has the molecular formula C13H10N2O3S and a molecular weight of 274.30 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4127819 |
| Molecular Formula | C13H10N2O3S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(NC1=NCCS1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C13H10N2O3S/c16-11(15-13-14-5-6-19-13)9-7-8-3-1-2-4-10(8)18-12(9)17/h1-4,7H,5-6H2,(H,14,15,16) |
| InChIKey | MREAOORYAPXIEB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|