C16H12N4O3S — CID 108727609
N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 108727609) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 108727609 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | N-(5,6-dimethyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | Cc1sc2nc(NC(=O)c3cc4ccccc4oc3=O)nn2c1C |
| InChI | InChI=1S/C16H12N4O3S/c1-8-9(2)24-16-18-15(19-20(8)16)17-13(21)11-7-10-5-3-4-6-12(10)23-14(11)22/h3-7H,1-2H3,(H,17,19,21) |
| InChIKey | PCZALMWTGMISDM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 89.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|