C19H13N3O3S — CID 110665891
N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 110665891) has the molecular formula C19H13N3O3S and a molecular weight of 363.40 g/mol. Its IUPAC name is N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 110665891 |
| Molecular Formula | C19H13N3O3S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(4-methyl-5-pyridin-3-yl-1,3-thiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | Cc1nc(NC(=O)c2cc3ccccc3oc2=O)sc1-c1cccnc1 |
| InChI | InChI=1S/C19H13N3O3S/c1-11-16(13-6-4-8-20-10-13)26-19(21-11)22-17(23)14-9-12-5-2-3-7-15(12)25-18(14)24/h2-10H,1H3,(H,21,22,23) |
| InChIKey | ZFLPQYKYOBQBIX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|