About N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide
N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide (PubChem CID 22993732) has the molecular formula C18H17N3OS
and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide |
| PubChem CID | 22993732 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(-c2cc(C)cc(C)c2)c(-c2cccnc2)s1 |
| InChI | InChI=1S/C18H17N3OS/c1-11-7-12(2)9-15(8-11)16-17(14-5-4-6-19-10-14)23-18(21-16)20-13(3)22/h4-10H,1-3H3,(H,20,21,22) |
| InChIKey | DPAGZXBCPKMLAP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide?
The IUPAC name of N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide (CID 22993732) is N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide.
What is the SMILES notation for N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide?
The canonical SMILES for N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide is CC(=O)Nc1nc(-c2cc(C)cc(C)c2)c(-c2cccnc2)s1.
What is the InChIKey of N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide?
The InChIKey is DPAGZXBCPKMLAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3OS/c1-11-7-12(2)9-15(8-11)16-17(14-5-4-6-19-10-14)23-18(21-16)20-13(3)22/h4-10H,1-3H3,(H,20,21,22).
What are the key properties of N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide?
N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide has a molecular weight of 323.42 g/mol, XLogP of 4.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,5-dimethylphenyl)-5-pyridin-3-yl-1,3-thiazol-2-yl]acetamide is sourced from PubChem (CID 22993732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).