C13H12N2O4S — CID 82226564
2-acetamido-4-(3-methoxyphenyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82226564) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-acetamido-4-(3-methoxyphenyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-acetamido-4-(3-methoxyphenyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82226564 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-acetamido-4-(3-methoxyphenyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1cccc(-c2nc(NC(C)=O)sc2C(=O)O)c1 |
| InChI | InChI=1S/C13H12N2O4S/c1-7(16)14-13-15-10(11(20-13)12(17)18)8-4-3-5-9(6-8)19-2/h3-6H,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | BFZOAMHKUJRSBM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |