C17H8Cl2N2O3S — CID 2150730
N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide (PubChem CID 2150730) has the molecular formula C17H8Cl2N2O3S and a molecular weight of 391.24 g/mol. Its IUPAC name is N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 2150730 |
| Molecular Formula | C17H8Cl2N2O3S |
| Molecular Weight | 391.24 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1nc2c(Cl)c(Cl)ccc2s1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C17H8Cl2N2O3S/c18-10-5-6-12-14(13(10)19)20-17(25-12)21-15(22)9-7-8-3-1-2-4-11(8)24-16(9)23/h1-7H,(H,20,21,22) |
| InChIKey | AOCGQUNPOIIUJM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|