C14H7Cl2N3O3S — CID 7193004
N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-nitrobenzamide (PubChem CID 7193004) has the molecular formula C14H7Cl2N3O3S and a molecular weight of 368.20 g/mol. Its IUPAC name is N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-nitrobenzamide.
| Compound Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 7193004 |
| Molecular Formula | C14H7Cl2N3O3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-nitrobenzamide |
| SMILES | O=C(Nc1nc2c(Cl)c(Cl)ccc2s1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H7Cl2N3O3S/c15-8-5-6-10-12(11(8)16)17-14(23-10)18-13(20)7-3-1-2-4-9(7)19(21)22/h1-6H,(H,17,18,20) |
| InChIKey | LCSFSPKDUSUIMG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|