C16H10Cl2N2O3S — CID 2150731
methyl 4-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamoyl]benzoate (PubChem CID 2150731) has the molecular formula C16H10Cl2N2O3S and a molecular weight of 381.24 g/mol. Its IUPAC name is methyl 4-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 4-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 2150731 |
| Molecular Formula | C16H10Cl2N2O3S |
| Molecular Weight | 381.24 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | methyl 4-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2nc3c(Cl)c(Cl)ccc3s2)cc1 |
| InChI | InChI=1S/C16H10Cl2N2O3S/c1-23-15(22)9-4-2-8(3-5-9)14(21)20-16-19-13-11(24-16)7-6-10(17)12(13)18/h2-7H,1H3,(H,19,20,21) |
| InChIKey | QTUXEHSEWHHHQQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |