C19H12Cl2N2OS — CID 16849433
N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-naphthalen-2-ylacetamide (PubChem CID 16849433) has the molecular formula C19H12Cl2N2OS and a molecular weight of 387.29 g/mol. Its IUPAC name is N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-naphthalen-2-ylacetamide.
| Compound Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 16849433 |
| Molecular Formula | C19H12Cl2N2OS |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-naphthalen-2-ylacetamide |
| SMILES | O=C(Cc1ccc2ccccc2c1)Nc1nc2c(Cl)c(Cl)ccc2s1 |
| InChI | InChI=1S/C19H12Cl2N2OS/c20-14-7-8-15-18(17(14)21)23-19(25-15)22-16(24)10-11-5-6-12-3-1-2-4-13(12)9-11/h1-9H,10H2,(H,22,23,24) |
| InChIKey | ZXEGDOXNDMWJJX-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |