C17H14Cl2N2O2S — CID 30307879
N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-methyl-2-phenoxypropanamide (PubChem CID 30307879) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-methyl-2-phenoxypropanamide.
| Compound Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-methyl-2-phenoxypropanamide |
|---|---|
| PubChem CID | 30307879 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-(4,5-dichloro-1,3-benzothiazol-2-yl)-2-methyl-2-phenoxypropanamide |
| SMILES | CC(C)(Oc1ccccc1)C(=O)Nc1nc2c(Cl)c(Cl)ccc2s1 |
| InChI | InChI=1S/C17H14Cl2N2O2S/c1-17(2,23-10-6-4-3-5-7-10)15(22)21-16-20-14-12(24-16)9-8-11(18)13(14)19/h3-9H,1-2H3,(H,20,21,22) |
| InChIKey | ZLMFJHVOTWKPGG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |