C16H11Cl2N3O2S2 — CID 3417887
N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-phenoxyacetamide (PubChem CID 3417887) has the molecular formula C16H11Cl2N3O2S2 and a molecular weight of 412.32 g/mol. Its IUPAC name is N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 3417887 |
| Molecular Formula | C16H11Cl2N3O2S2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | N-[(4,5-dichloro-1,3-benzothiazol-2-yl)carbamothioyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NC(=S)Nc1nc2c(Cl)c(Cl)ccc2s1 |
| InChI | InChI=1S/C16H11Cl2N3O2S2/c17-10-6-7-11-14(13(10)18)20-16(25-11)21-15(24)19-12(22)8-23-9-4-2-1-3-5-9/h1-7H,8H2,(H2,19,20,21,22,24) |
| InChIKey | NKDUMMCVJCFZKA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|