C13H14N4O2S2 — CID 960876
N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-phenoxyacetamide (PubChem CID 960876) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-phenoxyacetamide.
| Compound Name | N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 960876 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamothioyl]-2-phenoxyacetamide |
| SMILES | CCc1nnc(NC(=S)NC(=O)COc2ccccc2)s1 |
| InChI | InChI=1S/C13H14N4O2S2/c1-2-11-16-17-13(21-11)15-12(20)14-10(18)8-19-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H2,14,15,17,18,20) |
| InChIKey | BDYSABHVYNCVDC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|