C12H11Cl2N3O2S — CID 78767939
2-(3,5-dichlorophenoxy)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 78767939) has the molecular formula C12H11Cl2N3O2S and a molecular weight of 332.21 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(3,5-dichlorophenoxy)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 78767939 |
| Molecular Formula | C12H11Cl2N3O2S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)COc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C12H11Cl2N3O2S/c1-2-11-16-17-12(20-11)15-10(18)6-19-9-4-7(13)3-8(14)5-9/h3-5H,2,6H2,1H3,(H,15,17,18) |
| InChIKey | CDTQLJLMLVZOTQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |