C16H20ClN3O2S — CID 16551051
2-(4-chloro-3-methylphenoxy)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 16551051) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 16551051 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-(5-pentyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCCCc1nnc(NC(=O)COc2ccc(Cl)c(C)c2)s1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-3-4-5-6-15-19-20-16(23-15)18-14(21)10-22-12-7-8-13(17)11(2)9-12/h7-9H,3-6,10H2,1-2H3,(H,18,20,21) |
| InChIKey | MQRLRZGOGVKVEE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|