C21H23N3O2S — CID 7751334
N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-(2-phenylphenoxy)acetamide (PubChem CID 7751334) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-(2-phenylphenoxy)acetamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-(2-phenylphenoxy)acetamide |
|---|---|
| PubChem CID | 7751334 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-2-(2-phenylphenoxy)acetamide |
| SMILES | CCCCCc1nnc(NC(=O)COc2ccccc2-c2ccccc2)s1 |
| InChI | InChI=1S/C21H23N3O2S/c1-2-3-5-14-20-23-24-21(27-20)22-19(25)15-26-18-13-9-8-12-17(18)16-10-6-4-7-11-16/h4,6-13H,2-3,5,14-15H2,1H3,(H,22,24,25) |
| InChIKey | ZNHXAEOMVULPBN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|