C14H17N3O3S — CID 5202520
2-(2-methoxyphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 5202520) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5202520 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCc1nnc(NC(=O)COc2ccccc2OC)s1 |
| InChI | InChI=1S/C14H17N3O3S/c1-3-6-13-16-17-14(21-13)15-12(18)9-20-11-8-5-4-7-10(11)19-2/h4-5,7-8H,3,6,9H2,1-2H3,(H,15,17,18) |
| InChIKey | TUMNRTIWQYLGQP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |