C14H15N3O3S — CID 3477268
2-(2-formylphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 3477268) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(2-formylphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(2-formylphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 3477268 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(2-formylphenoxy)-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCc1nnc(NC(=O)COc2ccccc2C=O)s1 |
| InChI | InChI=1S/C14H15N3O3S/c1-2-5-13-16-17-14(21-13)15-12(19)9-20-11-7-4-3-6-10(11)8-18/h3-4,6-8H,2,5,9H2,1H3,(H,15,17,19) |
| InChIKey | ALXPPUQIPRMVTQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|