C14H17N3O2S — CID 7920328
N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-phenoxyacetamide (PubChem CID 7920328) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-phenoxyacetamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-phenoxyacetamide |
|---|---|
| PubChem CID | 7920328 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-phenoxyacetamide |
| SMILES | CCCCc1nnc(NC(=O)COc2ccccc2)s1 |
| InChI | InChI=1S/C14H17N3O2S/c1-2-3-9-13-16-17-14(20-13)15-12(18)10-19-11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3,(H,15,17,18) |
| InChIKey | VVUVGWADNHQHII-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |