C14H15ClN4O2S — CID 1400163
N-(4-chlorophenyl)-N'-(5-ethyl-1,3,4-thiadiazol-2-yl)butanediamide (PubChem CID 1400163) has the molecular formula C14H15ClN4O2S and a molecular weight of 338.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-N'-(5-ethyl-1,3,4-thiadiazol-2-yl)butanediamide.
| Compound Name | N-(4-chlorophenyl)-N'-(5-ethyl-1,3,4-thiadiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 1400163 |
| Molecular Formula | C14H15ClN4O2S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-(4-chlorophenyl)-N'-(5-ethyl-1,3,4-thiadiazol-2-yl)butanediamide |
| SMILES | CCc1nnc(NC(=O)CCC(=O)Nc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C14H15ClN4O2S/c1-2-13-18-19-14(22-13)17-12(21)8-7-11(20)16-10-5-3-9(15)4-6-10/h3-6H,2,7-8H2,1H3,(H,16,20)(H,17,19,21) |
| InChIKey | XQUFAFUVKNWNIN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |