About ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate
ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate (PubChem CID 54787271) has the molecular formula C10H15N3O3S
and a molecular weight of 257.31 g/mol. Its IUPAC name is ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate.
Analyze ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate?
The IUPAC name of ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate (CID 54787271) is ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate.
What is the SMILES notation for ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate?
The canonical SMILES for ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate is CCOC(=O)CCC(=O)Nc1nnc(CC)s1.
What is the InChIKey of ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate?
The InChIKey is BZLJPKCXLPYUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3S/c1-3-8-12-13-10(17-8)11-7(14)5-6-9(15)16-4-2/h3-6H2,1-2H3,(H,11,13,14).
What are the key properties of ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate?
ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate has a molecular weight of 257.31 g/mol, XLogP of 1.38, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoate is sourced from PubChem (CID 54787271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).