C11H17N3O3S — CID 144633513
ethyl 5-(5-acetamido-1,3,4-thiadiazol-2-yl)pentanoate (PubChem CID 144633513) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is ethyl 5-(5-acetamido-1,3,4-thiadiazol-2-yl)pentanoate.
| Compound Name | ethyl 5-(5-acetamido-1,3,4-thiadiazol-2-yl)pentanoate |
|---|---|
| PubChem CID | 144633513 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | ethyl 5-(5-acetamido-1,3,4-thiadiazol-2-yl)pentanoate |
| SMILES | CCOC(=O)CCCCc1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C11H17N3O3S/c1-3-17-10(16)7-5-4-6-9-13-14-11(18-9)12-8(2)15/h3-7H2,1-2H3,(H,12,14,15) |
| InChIKey | GKZIQQMUAGYMAV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|