C17H21N3O3S — CID 71534293
methyl 5-[5-[[2-(4-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanoate (PubChem CID 71534293) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is methyl 5-[5-[[2-(4-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanoate.
| Compound Name | methyl 5-[5-[[2-(4-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanoate |
|---|---|
| PubChem CID | 71534293 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | methyl 5-[5-[[2-(4-methylphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]pentanoate |
| SMILES | COC(=O)CCCCc1nnc(NC(=O)Cc2ccc(C)cc2)s1 |
| InChI | InChI=1S/C17H21N3O3S/c1-12-7-9-13(10-8-12)11-14(21)18-17-20-19-15(24-17)5-3-4-6-16(22)23-2/h7-10H,3-6,11H2,1-2H3,(H,18,20,21) |
| InChIKey | OCBIRFOZPWKHCW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|