C17H19ClN6OS2 — CID 139565335
2-(4-chlorophenyl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 139565335) has the molecular formula C17H19ClN6OS2 and a molecular weight of 422.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 139565335 |
| Molecular Formula | C17H19ClN6OS2 |
| Molecular Weight | 422.97 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CNc1nnc(CCCCc2nnc(NC(=O)Cc3ccc(Cl)cc3)s2)s1 |
| InChI | InChI=1S/C17H19ClN6OS2/c1-19-16-23-21-14(26-16)4-2-3-5-15-22-24-17(27-15)20-13(25)10-11-6-8-12(18)9-7-11/h6-9H,2-5,10H2,1H3,(H,19,23)(H,20,24,25) |
| InChIKey | DURMBBHPHLLMMR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.97 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|