C10H16N6S2 — CID 139565225
N-methyl-5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-amine (PubChem CID 139565225) has the molecular formula C10H16N6S2 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-methyl-5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-methyl-5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 139565225 |
| Molecular Formula | C10H16N6S2 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-methyl-5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(CCCCc2nnc(NC)s2)s1 |
| InChI | InChI=1S/C10H16N6S2/c1-11-9-15-13-7(17-9)5-3-4-6-8-14-16-10(12-2)18-8/h3-6H2,1-2H3,(H,11,15)(H,12,16) |
| InChIKey | BMZMVUZODPEDTP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|