C19H24N6O2S2 — CID 139565233
2-(2,5-dimethylphenoxy)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 139565233) has the molecular formula C19H24N6O2S2 and a molecular weight of 432.58 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 139565233 |
| Molecular Formula | C19H24N6O2S2 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[5-[4-[5-(methylamino)-1,3,4-thiadiazol-2-yl]butyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CNc1nnc(CCCCc2nnc(NC(=O)COc3cc(C)ccc3C)s2)s1 |
| InChI | InChI=1S/C19H24N6O2S2/c1-12-8-9-13(2)14(10-12)27-11-15(26)21-19-25-23-17(29-19)7-5-4-6-16-22-24-18(20-3)28-16/h8-10H,4-7,11H2,1-3H3,(H,20,24)(H,21,25,26) |
| InChIKey | QZYQPIGVZSWLET-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|