C17H24N4O2S — CID 39182914
4-amino-N-[5-[3-(2,4-dimethylphenoxy)propyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 39182914) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-amino-N-[5-[3-(2,4-dimethylphenoxy)propyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | 4-amino-N-[5-[3-(2,4-dimethylphenoxy)propyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 39182914 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-amino-N-[5-[3-(2,4-dimethylphenoxy)propyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | Cc1ccc(OCCCc2nnc(NC(=O)CCCN)s2)c(C)c1 |
| InChI | InChI=1S/C17H24N4O2S/c1-12-7-8-14(13(2)11-12)23-10-4-6-16-20-21-17(24-16)19-15(22)5-3-9-18/h7-8,11H,3-6,9-10,18H2,1-2H3,(H,19,21,22) |
| InChIKey | CSBFLQHGYVDQQG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|